* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SESAMEX |
CAS: | 51-14-9 |
English Synonyms: | SESAMEX |
MDL Number.: | MFCD01733470 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CCOCCOCCOC(C)Oc1ccc2c(c1)OCO2 |
InChi: | InChI=1S/C15H22O6/c1-3-16-6-7-17-8-9-18-12(2)21-13-4-5-14-15(10-13)20-11-19-14/h4-5,10,12H,3,6-9,11H2,1-2H3 |
InChiKey: | InChIKey=WABPPBHOPMUJHV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.