* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-TRP-VAL-OH |
CAS: | 51126-85-3 |
English Synonyms: | Z-TRP-VAL-OH |
MDL Number.: | MFCD00238509 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | CC(C)[C@@H](C(=O)O)NC(=O)[C@H](Cc1c[nH]c2c1cccc2)NC(=O)OCc3ccccc3 |
InChi: | InChI=1S/C24H27N3O5/c1-15(2)21(23(29)30)27-22(28)20(12-17-13-25-19-11-7-6-10-18(17)19)26-24(31)32-14-16-8-4-3-5-9-16/h3-11,13,15,20-21,25H,12,14H2,1-2H3,(H,26,31)(H,27,28)(H,29,30)/t20-,21-/m0/s1 |
InChiKey: | InChIKey=SWSCYGNQYDTODY-SFTDATJTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.