Molecular Structure:
CAS No.:
51127-21-0
Product Name.:
CCD No.:CCD00264148
Formula:C12 H13 N O4
MolWeight:235.238
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(5)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | DL-5-BENZOYLAMINO-5-METHYL-4-OXO-1,3-DIOXANE |
| CAS： | 51127-21-0 |
| English Synonyms： | DL-5-BENZOYLAMINO-5-METHYL-4-OXO-1,3-DIOXANE |
| MDL Number.： | MFCD01863310 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CC1(COCOC1=O)NC(=O)c2ccccc2 |
| InChi： | InChI=1S/C12H13NO4/c1-12(7-16-8-17-11(12)15)13-10(14)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,13,14) |
| InChiKey： | InChIKey=CBPVXQIYADPGSJ-UHFFFAOYSA-N |
|
|
| Melting Point： | 154-159 DEG C |
| Comments： | HAZARD: S24/25 |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
