* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRIDINE, 2,6-DIFLUORO-, HYDRATE |
| CAS: | 511519-47-4 |
| English Synonyms: | PYRIDINE, 2,6-DIFLUORO-, HYDRATE |
| MDL Number.: | MFCD13175308 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1cc(nc(c1)F)F.O |
| InChi: | InChI=1S/C5H3F2N.H2O/c6-4-2-1-3-5(7)8-4;/h1-3H;1H2 |
| InChiKey: | InChIKey=VAMBFYQXFNKAMG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.