* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (2R,5S)-REL-2,5-DIMETHYL-4-PIPERIDINONE |
CAS: | 51153-62-9 |
English Synonyms: | (2R,5S)-REL-2,5-DIMETHYL-4-PIPERIDINONE ; 4-PIPERIDINONE, 2,5-DIMETHYL-, (2R,5S)-REL- |
MDL Number.: | MFCD17677428 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C[C@@H]1CC(=O)[C@H](CN1)C |
InChi: | InChI=1S/C7H13NO/c1-5-4-8-6(2)3-7(5)9/h5-6,8H,3-4H2,1-2H3/t5-,6+/m0/s1 |
InChiKey: | InChIKey=KZAGJHDAWXVDQX-NTSWFWBYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.