* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDOLE, 3-(2-AMINOPROPYL)-, ACETATE |
CAS: | 5118-26-3 |
English Synonyms: | INDOLE, 3-(2-AMINOPROPYL)-, ACETATE |
MDL Number.: | MFCD01719192 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CC(Cc1c[nH]c2c1cccc2)N.CC(=O)O |
InChi: | InChI=1S/C11H14N2.C2H4O2/c1-8(12)6-9-7-13-11-5-3-2-4-10(9)11;1-2(3)4/h2-5,7-8,13H,6,12H2,1H3;1H3,(H,3,4) |
InChiKey: | InChIKey=NMZSAMXFINECBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.