* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | YAMOGENIN |
| CAS: | 512-06-1 |
| English Synonyms: | YAMOGENIN |
| MDL Number.: | MFCD12031641 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O)C)C)C)OC1 |
| InChi: | InChI=1S/C27H42O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28H,6-15H2,1-4H3/t16?,17-,19-,20+,21-,22-,23-,24-,25-,26-,27+/m0/s1 |
| InChiKey: | InChIKey=WQLVFSAGQJTQCK-DXZIWIJNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.