* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-INDOLE, 3-(4-NITROPHENYL)- |
CAS: | 51206-84-9 |
English Synonyms: | 3-(4-NITROPHENYL)-1H-INDOLE ; 1H-INDOLE, 3-(4-NITROPHENYL)- |
MDL Number.: | MFCD17015558 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(c[nH]2)c3ccc(cc3)[N+](=O)[O-] |
InChi: | InChI=1S/C14H10N2O2/c17-16(18)11-7-5-10(6-8-11)13-9-15-14-4-2-1-3-12(13)14/h1-9,15H |
InChiKey: | InChIKey=KWFMXELQSVUTCN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.