Molecular Structure:
CAS No.:
512178-70-0
Product Name.:
CCD No.:CCD04478070
Formula:C6 H12 O2 S
MolWeight:148.225
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 1,2-OXATHIOLANE, 3-PROPYL-, 2-OXIDE, (2S,3S)- |
| CAS： | 512178-70-0 |
| English Synonyms： | 1,2-OXATHIOLANE, 3-PROPYL-, 2-OXIDE, (2S,3S)- |
| MDL Number.： | MFCD18828369 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | CCC[C@H]1CCOS1=O |
| InChi： | InChI=1S/C6H12O2S/c1-2-3-6-4-5-8-9(6)7/h6H,2-5H2,1H3/t6-,9?/m0/s1 |
| InChiKey： | InChIKey=LBUIAXNSGCVXNF-AADKRJSRSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
