* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 6,8-DIPRENYLGENISTEIN |
CAS: | 51225-28-6 |
English Synonyms: | 6,8-DIPRENYLGENISTEIN |
MDL Number.: | MFCD16876371 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(=CCc1c(c(c2c(c1O)c(=O)c(co2)c3ccc(cc3)O)CC=C(C)C)O)C |
InChi: | InChI=1S/C25H26O5/c1-14(2)5-11-18-22(27)19(12-6-15(3)4)25-21(23(18)28)24(29)20(13-30-25)16-7-9-17(26)10-8-16/h5-10,13,26-28H,11-12H2,1-4H3 |
InChiKey: | InChIKey=UCHYSPNEUSDFQR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.