* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2,5-MORPHOLINEDIONE, 3-(HYDROXYMETHYL)-, (3S)- |
CAS: | 512802-58-3 |
English Synonyms: | 2,5-MORPHOLINEDIONE, 3-(HYDROXYMETHYL)-, (3S)- |
MDL Number.: | MFCD18828314 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C1C(=O)N[C@H](C(=O)O1)CO |
InChi: | InChI=1S/C5H7NO4/c7-1-3-5(9)10-2-4(8)6-3/h3,7H,1-2H2,(H,6,8)/t3-/m0/s1 |
InChiKey: | InChIKey=XJIDKHOPGCINLS-VKHMYHEASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.