* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (Z)-4-(PROPYLAMINO)-3-BUTEN-2-ONE |
CAS: | 51287-94-6 |
English Synonyms: | (Z)-4-(PROPYLAMINO)-3-BUTEN-2-ONE ; 3-BUTEN-2-ONE, 4-(PROPYLAMINO)-, (Z)- |
MDL Number.: | MFCD18834780 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCN/C=C\C(=O)C |
InChi: | InChI=1S/C7H13NO/c1-3-5-8-6-4-7(2)9/h4,6,8H,3,5H2,1-2H3/b6-4- |
InChiKey: | InChIKey=PGXCOTMQKOPYOF-XQRVVYSFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.