* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-METHOXY-2,4-DIHYDRO-3H-1,2,4-TRIAZOL-3-ONE |
CAS: | 51291-82-8 |
English Synonyms: | 3-METHOXY-4,5-DIHYDRO-1H-1,2,4-TRIAZOL-5-ONE ; 5-METHOXY-2,4-DIHYDRO-3H-1,2,4-TRIAZOL-3-ONE |
MDL Number.: | MFCD09955586 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | COc1[nH]c(=O)[nH]n1 |
InChi: | InChI=1S/C3H5N3O2/c1-8-3-4-2(7)5-6-3/h1H3,(H2,4,5,6,7) |
InChiKey: | InChIKey=ZDINYQOPDQBHQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.