* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2,3-DIISOPROPYLPHENOL |
CAS: | 51335-39-8 |
English Synonyms: | 2,3-BIS(PROPAN-2-YL)PHENOL ; 2,3-DIISOPROPYLPHENOL |
MDL Number.: | MFCD16997207 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C)c1cccc(c1C(C)C)O |
InChi: | InChI=1S/C12H18O/c1-8(2)10-6-5-7-11(13)12(10)9(3)4/h5-9,13H,1-4H3 |
InChiKey: | InChIKey=ZEFOXNBIQIPHOP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.