* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-AMINO-HEPTAN-2-OL |
CAS: | 51411-48-4 |
English Synonyms: | 1-AMINO-HEPTAN-2-OL ; 1-AMINO-2-HEPTANOL |
MDL Number.: | MFCD09260536 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CCCCCC(CN)O |
InChi: | InChI=1S/C7H17NO/c1-2-3-4-5-7(9)6-8/h7,9H,2-6,8H2,1H3 |
InChiKey: | InChIKey=QLELJGOOIWJCOZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.