* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(4-MORPHOLINYL)-1H-1,2,4-TRIAZOL-3-AMINE |
CAS: | 51420-46-3 |
English Synonyms: | 5-(4-MORPHOLINYL)-1H-1,2,4-TRIAZOL-3-AMINE ; 5-MORPHOLIN-4-YL-1H-[1,2,4]TRIAZOL-3-YLAMINE |
MDL Number.: | MFCD17078893 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C1COCCN1c2[nH]nc(n2)N |
InChi: | InChI=1S/C6H11N5O/c7-5-8-6(10-9-5)11-1-3-12-4-2-11/h1-4H2,(H3,7,8,9,10) |
InChiKey: | InChIKey=BPOWERXZKXCBFE-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.