Molecular Structure:
CAS No.:
514797-98-9
Product Name.:
CCD No.:CCD04016332
Formula:C5 H2 Cl F I N
MolWeight:257.429
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 5-CHLORO-3-FLUORO-2-IODOPYRIDINE |
| CAS： | 514797-98-9 |
| English Synonyms： | 5-CHLORO-3-FLUORO-2-IODOPYRIDINE ; ABBYPHARMA AP-30-5967 |
| MDL Number.： | MFCD18256751 |
| H bond acceptor： | 1 |
| H bond donor： | 0 |
| Smile： | c1c(cnc(c1F)I)Cl |
| InChi： | InChI=1S/C5H2ClFIN/c6-3-1-4(7)5(8)9-2-3/h1-2H |
| InChiKey： | InChIKey=CKAAMIXTBBVWRV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
