* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,2,4-TRIAZIN-3(2H)-ONE, 5-(ETHYLAMINO)-6-METHYL- |
| CAS: | 515116-39-9 |
| English Synonyms: | 5-(ETHYLAMINO)-6-METHYL-2,3-DIHYDRO-1,2,4-TRIAZIN-3-ONE ; 1,2,4-TRIAZIN-3(2H)-ONE, 5-(ETHYLAMINO)-6-METHYL- ; 5-(ETHYLAMINO)-6-METHYL-1,2,4-TRIAZIN-3(2H)-ONE |
| MDL Number.: | MFCD06641918 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCNc1c(n[nH]c(=O)n1)C |
| InChi: | InChI=1S/C6H10N4O/c1-3-7-5-4(2)9-10-6(11)8-5/h3H2,1-2H3,(H2,7,8,10,11) |
| InChiKey: | InChIKey=KORUXMHJWSGHFL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.