* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4-ETHYL-3-NITROANILINE |
CAS: | 51529-96-5 |
English Synonyms: | 4-ETHYL-3-NITROANILINE |
MDL Number.: | MFCD09971452 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1ccc(cc1[N+](=O)[O-])N |
InChi: | InChI=1S/C8H10N2O2/c1-2-6-3-4-7(9)5-8(6)10(11)12/h3-5H,2,9H2,1H3 |
InChiKey: | InChIKey=OUVUXCBBKYHSLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.