* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,7-DIOXOOCTANOIC ACID |
CAS: | 51568-19-5 |
English Synonyms: | 5,7-DIOXOOCTANOIC ACID |
MDL Number.: | MFCD00083300 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(=O)CC(=O)CCCC(=O)O |
InChi: | InChI=1S/C8H12O4/c1-6(9)5-7(10)3-2-4-8(11)12/h2-5H2,1H3,(H,11,12) |
InChiKey: | InChIKey=JOQHEPMHRUHJFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.