* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3-Propanedione, 1,3-di-2-naphthalenyl- |
CAS: | 51583-97-2 |
English Synonyms: | 1,3-PROPANEDIONE, 1,3-DI-2-NAPHTHALENYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1=C(C=CC2=CC=CC=C12)C(CC(=O)C1=CC2=CC=CC=C2C=C1)=O |
InChi: | InChI=1S/C23H16O2/c24-22(20-11-9-16-5-1-3-7-18(16)13-20)15-23(25)21-12-10-17-6-2-4-8-19(17)14-21/h1-14H,15H2 |
InChiKey: | InChIKey=BSYFDFPTOXRGMP-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.