* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ERYTHRARTINE |
CAS: | 51666-26-3 |
English Synonyms: | ERYTHRARTINE |
MDL Number.: | MFCD17214792 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COc1cc2c(cc1OC)[C@]34C[C@H](C=CC3=CCN4C[C@@H]2O)OC |
InChi: | InChI=1S/C19H23NO4/c1-22-13-5-4-12-6-7-20-11-16(21)14-8-17(23-2)18(24-3)9-15(14)19(12,20)10-13/h4-6,8-9,13,16,21H,7,10-11H2,1-3H3/t13-,16-,19-/m0/s1 |
InChiKey: | InChIKey=QWWCVLZNFFVFTR-AXHNFQJDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.