* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-ETHOXYCYCLOHEXA-2,5-DIENE-1,4-DIONE |
| CAS: | 51767-58-9 |
| English Synonyms: | ABLOCK AB-10-4110 ; 2-ETHOXYCYCLOHEXA-2,5-DIENE-1,4-DIONE ; 2-ETHOXY-[1,4]BENZOQUINONE |
| MDL Number.: | MFCD16877708 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCOC1=CC(=O)C=CC1=O |
| InChi: | InChI=1S/C8H8O3/c1-2-11-8-5-6(9)3-4-7(8)10/h3-5H,2H2,1H3 |
| InChiKey: | InChIKey=DFHHICWDTCBHEX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.