* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,4-Dihydro-5-(2-oxiranylmethoxy)-2(1H)-quinolinone |
CAS: | 51781-14-7 |
English Synonyms: | 3,4-DIHYDRO-5-(2-OXIRANYLMETHOXY)-2(1H)-QUINOLINONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | O1C(C1)COC1=C2CCC(NC2=CC=C1)=O |
InChi: | InChI=1S/C12H13NO3/c14-12-5-4-9-10(13-12)2-1-3-11(9)16-7-8-6-15-8/h1-3,8H,4-7H2,(H,13,14) |
InChiKey: | InChIKey=VQTWQOBNPISQPG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.