* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (1R)-1-(PYRIDIN-2-YL)BUT-3-EN-1-OL |
CAS: | 517907-57-2 |
English Synonyms: | (1R)-1-(PYRIDIN-2-YL)BUT-3-EN-1-OL ; (AR)-A-2-PROPEN-1-YL-2-PYRIDINEMETHANOL |
MDL Number.: | MFCD18427812 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C=CC[C@H](c1ccccn1)O |
InChi: | InChI=1S/C9H11NO/c1-2-5-9(11)8-6-3-4-7-10-8/h2-4,6-7,9,11H,1,5H2/t9-/m1/s1 |
InChiKey: | InChIKey=CITJKEXGKDUPEL-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.