* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | AS-703026 |
CAS: | 518347-76-7 |
English Synonyms: | AS-703026 ; N-[1-(4-CYANOPHENOXY)-3-(1H-IMIDAZOL-1-YL)PROPAN-2-YL]-4-IODOBENZAMIDE |
MDL Number.: | MFCD18633272 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1cc(ccc1C#N)OCC(Cn2ccnc2)NC(=O)c3ccc(cc3)I |
InChi: | InChI=1S/C20H17IN4O2/c21-17-5-3-16(4-6-17)20(26)24-18(12-25-10-9-23-14-25)13-27-19-7-1-15(11-22)2-8-19/h1-10,14,18H,12-13H2,(H,24,26) |
InChiKey: | InChIKey=VNJZUFANCKZCQJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.