Molecular Structure:
CAS No.:
52090-78-5
Product Name.:
CCD No.:CCD04016678
Formula:C7 H6 Br N3
MolWeight:212.049
![3-BROMO-5-METHYL-1H-PYRAZOLO[4,3-B]PYRIDINE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(8)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | 3-BROMO-5-METHYL-1H-PYRAZOLO[4,3-B]PYRIDINE |
| CAS： | 52090-78-5 |
| English Synonyms： | 3-BROMO-5-METHYL-1H-PYRAZOLO[4,3-B]PYRIDINE ; ABBYPHARMA AP-30-6644 |
| MDL Number.： | MFCD18257097 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | Cc1ccc2c(n1)c(n[nH]2)Br |
| InChi： | InChI=1S/C7H6BrN3/c1-4-2-3-5-6(9-4)7(8)11-10-5/h2-3H,1H3,(H,10,11) |
| InChiKey： | InChIKey=NOMFNCPFEGECCQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
