* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-(1H-INDOL-2-YL)ETHAN-1-OL |
CAS: | 52098-05-2 |
English Synonyms: | 2-(1H-INDOL-2-YL)ETHAN-1-OL ; 2-(1H-INDOL-2-YL)ETHANOL |
MDL Number.: | MFCD18633167 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)cc([nH]2)CCO |
InChi: | InChI=1S/C10H11NO/c12-6-5-9-7-8-3-1-2-4-10(8)11-9/h1-4,7,11-12H,5-6H2 |
InChiKey: | InChIKey=JZYHZABGLQFCHU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.