* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | I-SO-IAA |
CAS: | 521060-37-7 |
English Synonyms: | I-SO-IAA |
MDL Number.: | MFCD09953913 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | CC\1(c2cc(ccc2N(/C1=C\C=C\C=C\3/C(=O)c4ccccc4S3(=O)=O)CCCS(=O)(=O)[O-])NC(=O)CI)C.[Na+] |
InChi: | InChI=1S/C27H27IN2O7S2.Na/c1-27(2)20-16-18(29-25(31)17-28)12-13-21(20)30(14-7-15-38(33,34)35)24(27)11-6-5-10-23-26(32)19-8-3-4-9-22(19)39(23,36)37;/h3-6,8-13,16H,7,14-15,17H2,1-2H3,(H,29,31)(H,33,34,35);/q;+1/p-1/b6-5+,23-10+,24-11-; |
InChiKey: | InChIKey=KEQBZXMZCJNECQ-DQCHEPJZSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.