* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-[(5R)-5-METHYL-1-CYCLOPENTEN-1-YL]-ETHANONE |
CAS: | 521086-81-7 |
English Synonyms: | ETHANONE, 1-[(5R)-5-METHYL-1-CYCLOPENTEN-1-YL]- ; 1-[(5R)-5-METHYL-1-CYCLOPENTEN-1-YL]-ETHANONE |
MDL Number.: | MFCD18829123 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C[C@@H]1CCC=C1C(=O)C |
InChi: | InChI=1S/C8H12O/c1-6-4-3-5-8(6)7(2)9/h5-6H,3-4H2,1-2H3/t6-/m1/s1 |
InChiKey: | InChIKey=FQPWZNFAKNQLON-ZCFIWIBFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.