* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | THIAZOLIDINE, 3-ACETYL-2-ETHYL-, (2R)- |
CAS: | 521317-01-1 |
English Synonyms: | THIAZOLIDINE, 3-ACETYL-2-ETHYL-, (2R)- |
MDL Number.: | MFCD18829595 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC[C@@H]1N(CCS1)C(=O)C |
InChi: | InChI=1S/C7H13NOS/c1-3-7-8(6(2)9)4-5-10-7/h7H,3-5H2,1-2H3/t7-/m1/s1 |
InChiKey: | InChIKey=PHJUXEINVBUAET-SSDOTTSWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.