* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2,3,6-TRICHLORO-4-METHYLPYRIDINE |
CAS: | 52137-65-2 |
English Synonyms: | 2,3,6-TRICHLORO-4-METHYLPYRIDINE |
MDL Number.: | MFCD08361785 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cc1cc(nc(c1Cl)Cl)Cl |
InChi: | InChI=1S/C6H4Cl3N/c1-3-2-4(7)10-6(9)5(3)8/h2H,1H3 |
InChiKey: | InChIKey=PLTVMXVJDCPHMP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.