* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | MINDOPERONE |
| CAS: | 52157-83-2 |
| English Synonyms: | MINDOPERONE |
| MDL Number.: | MFCD00869152 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1c(c2ccc(cc2[nH]1)OC)C3CCN(CC3)CCCC(=O)c4ccc(cc4)F |
| InChi: | InChI=1S/C25H29FN2O2/c1-17-25(22-10-9-21(30-2)16-23(22)27-17)19-11-14-28(15-12-19)13-3-4-24(29)18-5-7-20(26)8-6-18/h5-10,16,19,27H,3-4,11-15H2,1-2H3 |
| InChiKey: | InChIKey=URAQFJBGJKTOGQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.