* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4,4'-(2,2-DIMETHYLPROPANE-1,1-DIYL)DIPHENOL |
CAS: | 52173-65-6 |
English Synonyms: | 4,4'-(2,2-DIMETHYLPROPANE-1,1-DIYL)DIPHENOL |
MDL Number.: | MFCD16876271 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CC(C)(C)C(c1ccc(cc1)O)c2ccc(cc2)O |
InChi: | InChI=1S/C17H20O2/c1-17(2,3)16(12-4-8-14(18)9-5-12)13-6-10-15(19)11-7-13/h4-11,16,18-19H,1-3H3 |
InChiKey: | InChIKey=OMFKAAYGALHAKD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.