* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BICYCLO[4.2.0]OCTA-1,3,5-TRIENE-7-CARBOXAMIDE |
CAS: | 52199-49-2 |
English Synonyms: | BICYCLO[4.2.0]OCTA-1,3,5-TRIENE-7-CARBOXAMIDE |
MDL Number.: | MFCD18827084 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)CC2C(=O)N |
InChi: | InChI=1S/C9H9NO/c10-9(11)8-5-6-3-1-2-4-7(6)8/h1-4,8H,5H2,(H2,10,11) |
InChiKey: | InChIKey=VMKBPBZBUCQWTN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.