* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(3-BROMOPROPYL)PHENOL |
CAS: | 52273-55-9 |
English Synonyms: | 4-(3-BROMOPROPYL)PHENOL |
MDL Number.: | MFCD09744419 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(ccc1CCCBr)O |
InChi: | InChI=1S/C9H11BrO/c10-7-1-2-8-3-5-9(11)6-4-8/h3-6,11H,1-2,7H2 |
InChiKey: | InChIKey=SIJRSDOJOBGBJP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.