* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SEQUOYITOL |
| CAS: | 523-92-2 |
| English Synonyms: | 5-O-METHYL-MYO-INOSITOL ; SEQUOYITOL |
| MDL Number.: | MFCD00238681 |
| H bond acceptor: | 6 |
| H bond donor: | 5 |
| Smile: | CO[C@H]1[C@@H]([C@H]([C@H]([C@H]([C@@H]1O)O)O)O)O |
| InChi: | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3+,4-,5-,6+,7+ |
| InChiKey: | InChIKey=DSCFFEYYQKSRSV-GWJPIIGYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.