* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1,3-CYCLOPENTANEDIOL, 5-(HYDROXYMETHYL)-1-METHYL-, (1R,3R,5R)- |
CAS: | 524011-38-9 |
English Synonyms: | 1,3-CYCLOPENTANEDIOL, 5-(HYDROXYMETHYL)-1-METHYL-, (1R,3R,5R)- |
MDL Number.: | MFCD18828332 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | C[C@]1(C[C@@H](C[C@@H]1CO)O)O |
InChi: | InChI=1S/C7H14O3/c1-7(10)3-6(9)2-5(7)4-8/h5-6,8-10H,2-4H2,1H3/t5-,6-,7-/m1/s1 |
InChiKey: | InChIKey=BUVYIHTUFFQYOQ-FSDSQADBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.