* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzenebutanal, 3,4-dimethoxy- |
CAS: | 52417-29-5 |
English Synonyms: | BENZENEBUTANAL, 3,4-DIMETHOXY- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | COC=1C=C(C=CC1OC)CCCC=O |
InChi: | InChI=1S/C12H16O3/c1-14-11-7-6-10(5-3-4-8-13)9-12(11)15-2/h6-9H,3-5H2,1-2H3 |
InChiKey: | InChIKey=HXBRZTGSCVOUQD-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.