* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,4-IMIDAZOLIDINEDIONE, 5-ETHYL-5-(3-THIENYL)-, (5S)- |
CAS: | 525600-06-0 |
English Synonyms: | 2,4-IMIDAZOLIDINEDIONE, 5-ETHYL-5-(3-THIENYL)-, (5S)- |
MDL Number.: | MFCD18832087 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC[C@@]1(C(=O)NC(=O)N1)c2ccsc2 |
InChi: | InChI=1S/C9H10N2O2S/c1-2-9(6-3-4-14-5-6)7(12)10-8(13)11-9/h3-5H,2H2,1H3,(H2,10,11,12,13)/t9-/m0/s1 |
InChiKey: | InChIKey=AOPHLKVBNOPZAG-VIFPVBQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.