* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ACTIPHENOL |
CAS: | 526-02-3 |
English Synonyms: | ACTIPHENOL |
MDL Number.: | MFCD09752702 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1cc(c(c(c1)C(=O)CC2CC(=O)NC(=O)C2)O)C |
InChi: | InChI=1S/C15H17NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h3-4,10,20H,5-7H2,1-2H3,(H,16,18,19) |
InChiKey: | InChIKey=YTLMIHBTPWTPEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.