* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XINOMILINE |
| CAS: | 52832-91-4 |
| English Synonyms: | 4,4-DIMETHYL-4,5-DIHYDRO-1,3-OXAZOL-2-AMINE ; XINOMILINE |
| MDL Number.: | MFCD00868739 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC1(COC(=N1)N)C |
| InChi: | InChI=1S/C5H10N2O/c1-5(2)3-8-4(6)7-5/h3H2,1-2H3,(H2,6,7) |
| InChiKey: | InChIKey=OHCXSLPXSUWTKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.