* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-ISOINDOL-5-OL, OCTAHYDRO-, HYDROCHLORIDE (1:1), (3AR,5S,7AS)-REL- |
CAS: | 52865-01-7 |
English Synonyms: | 1H-ISOINDOL-5-OL, OCTAHYDRO-, HYDROCHLORIDE (1:1), (3AR,5S,7AS)-REL- |
MDL Number.: | MFCD18071923 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C1C[C@@H]2CNC[C@@H]2C[C@H]1O.Cl |
InChi: | InChI=1S/C8H15NO.ClH/c10-8-2-1-6-4-9-5-7(6)3-8;/h6-10H,1-5H2;1H/t6-,7+,8+;/m1./s1 |
InChiKey: | InChIKey=RQZXEQGQTRITTG-MWDCIYOWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.