* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | MULTIFLORINE |
CAS: | 529-80-6 |
English Synonyms: | MULTIFLORINE |
MDL Number.: | MFCD09970624 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C1CCN2C[C@@H]3C[C@H]([C@@H]2C1)CN4[C@@H]3CC(=O)C=C4 |
InChi: | InChI=1S/C15H22N2O/c18-13-4-6-17-9-11-7-12(15(17)8-13)10-16-5-2-1-3-14(11)16/h4,6,11-12,14-15H,1-3,5,7-10H2/t11-,12-,14-,15+/m0/s1 |
InChiKey: | InChIKey=HQSKZPOVBDNEGN-NZBPQXDJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.