* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-BUTEN-1-AMINE, N,N-DIETHYL-, (1Z)- |
CAS: | 529484-59-1 |
English Synonyms: | 1-BUTEN-1-AMINE, N,N-DIETHYL-, (1Z)- |
MDL Number.: | MFCD18835072 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC/C=C\N(CC)CC |
InChi: | InChI=1S/C8H17N/c1-4-7-8-9(5-2)6-3/h7-8H,4-6H2,1-3H3/b8-7- |
InChiKey: | InChIKey=QQWSFINPSFBGMA-FPLPWBNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.