* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6,6-DIFLUORO-1,4-DIAZEPANE |
CAS: | 529509-58-8 |
English Synonyms: | 6,6-DIFLUORO-1,4-DIAZEPANE |
MDL Number.: | MFCD17015571 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C1CNCC(CN1)(F)F |
InChi: | InChI=1S/C5H10F2N2/c6-5(7)3-8-1-2-9-4-5/h8-9H,1-4H2 |
InChiKey: | InChIKey=QETGEMJXBQDLPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.