* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AMMONIUM M AND ELATE |
CAS: | 530-31-4 |
English Synonyms: | AMMONIUM M AND ELATE |
MDL Number.: | MFCD00050582 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)C(C(=O)O)O.N |
InChi: | InChI=1S/C8H8O3.H3N/c9-7(8(10)11)6-4-2-1-3-5-6;/h1-5,7,9H,(H,10,11);1H3 |
InChiKey: | InChIKey=BDEXTKUJIZCFST-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.