* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(2,2-DIFLUORO-BENZO[1,3]DIOXOL-4-YL)-PROPAN-1-OL |
CAS: | 531508-38-0 |
English Synonyms: | 3-(2,2-DIFLUORO-BENZO[1,3]DIOXOL-4-YL)-PROPAN-1-OL |
MDL Number.: | MFCD09927397 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(c2c(c1)OC(O2)(F)F)CCCO |
InChi: | InChI=1S/C10H10F2O3/c11-10(12)14-8-5-1-3-7(4-2-6-13)9(8)15-10/h1,3,5,13H,2,4,6H2 |
InChiKey: | InChIKey=WJZMKLPTTMCBEU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.