* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(PYRIDIN-2-YL)IMIDAZOLIDIN-2-ONE |
| CAS: | 53159-76-5 |
| English Synonyms: | 1-(PYRIDIN-2-YL)IMIDAZOLIDIN-2-ONE |
| MDL Number.: | MFCD08060123 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccnc(c1)N2CCNC2=O |
| InChi: | InChI=1S/C8H9N3O/c12-8-10-5-6-11(8)7-3-1-2-4-9-7/h1-4H,5-6H2,(H,10,12) |
| InChiKey: | InChIKey=QNTITXYHUMSSKB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.