* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FLUPERAMIDE |
| CAS: | 53179-10-5 |
| English Synonyms: | FLUPERAMIDE |
| MDL Number.: | MFCD00866592 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CN(C)C(=O)C(CCN1CCC(CC1)(c2ccc(c(c2)C(F)(F)F)Cl)O)(c3ccccc3)c4ccccc4 |
| InChi: | InChI=1S/C30H32ClF3N2O2/c1-35(2)27(37)29(22-9-5-3-6-10-22,23-11-7-4-8-12-23)17-20-36-18-15-28(38,16-19-36)24-13-14-26(31)25(21-24)30(32,33)34/h3-14,21,38H,15-20H2,1-2H3 |
| InChiKey: | InChIKey=WPYGCZCMGMVGNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.